C18H32N2O4 — CID 171833915
6-(2,5-dioxo-3-propan-2-ylpyrrolidin-1-yl)-N-(4-hydroxy-2-methylbutan-2-yl)hexanamide (PubChem CID 171833915) has the molecular formula C18H32N2O4 and a molecular weight of 340.46 g/mol. Its IUPAC name is 6-(2,5-dioxo-3-propan-2-ylpyrrolidin-1-yl)-N-(4-hydroxy-2-methylbutan-2-yl)hexanamide.
| Compound Name | 6-(2,5-dioxo-3-propan-2-ylpyrrolidin-1-yl)-N-(4-hydroxy-2-methylbutan-2-yl)hexanamide |
|---|---|
| PubChem CID | 171833915 |
| Molecular Formula | C18H32N2O4 |
| Molecular Weight | 340.46 g/mol |
| Exact Mass | 340.24 |
| IUPAC Name | 6-(2,5-dioxo-3-propan-2-ylpyrrolidin-1-yl)-N-(4-hydroxy-2-methylbutan-2-yl)hexanamide |
| SMILES | CC(C)C1CC(=O)N(CCCCCC(=O)NC(C)(C)CCO)C1=O |
| InChI | InChI=1S/C18H32N2O4/c1-13(2)14-12-16(23)20(17(14)24)10-7-5-6-8-15(22)19-18(3,4)9-11-21/h13-14,21H,5-12H2,1-4H3,(H,19,22) |
| InChIKey | TYLYZPZBFSREFX-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.46 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|