C17H28F3NO2 — CID 130232703
1-[(6R)-7-methyl-6-(trifluoromethyl)octyl]-3-propan-2-ylpyrrolidine-2,5-dione (PubChem CID 130232703) has the molecular formula C17H28F3NO2 and a molecular weight of 335.41 g/mol. Its IUPAC name is 1-[(6R)-7-methyl-6-(trifluoromethyl)octyl]-3-propan-2-ylpyrrolidine-2,5-dione.
| Compound Name | 1-[(6R)-7-methyl-6-(trifluoromethyl)octyl]-3-propan-2-ylpyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 130232703 |
| Molecular Formula | C17H28F3NO2 |
| Molecular Weight | 335.41 g/mol |
| Exact Mass | 335.21 |
| IUPAC Name | 1-[(6R)-7-methyl-6-(trifluoromethyl)octyl]-3-propan-2-ylpyrrolidine-2,5-dione |
| SMILES | CC(C)C1CC(=O)N(CCCCC[C@H](C(C)C)C(F)(F)F)C1=O |
| InChI | InChI=1S/C17H28F3NO2/c1-11(2)13-10-15(22)21(16(13)23)9-7-5-6-8-14(12(3)4)17(18,19)20/h11-14H,5-10H2,1-4H3/t13?,14-/m1/s1 |
| InChIKey | GOIWSNHBHXGJRW-ARLHGKGLSA-N |
| XLogP | 4.41 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.41 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|