C13H22FNO2 — CID 164683801
1-(6-fluoro-6-methyloctyl)pyrrolidine-2,5-dione (PubChem CID 164683801) has the molecular formula C13H22FNO2 and a molecular weight of 243.32 g/mol. Its IUPAC name is 1-(6-fluoro-6-methyloctyl)pyrrolidine-2,5-dione.
| Compound Name | 1-(6-fluoro-6-methyloctyl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 164683801 |
| Molecular Formula | C13H22FNO2 |
| Molecular Weight | 243.32 g/mol |
| Exact Mass | 243.16 |
| IUPAC Name | 1-(6-fluoro-6-methyloctyl)pyrrolidine-2,5-dione |
| SMILES | CCC(C)(F)CCCCCN1C(=O)CCC1=O |
| InChI | InChI=1S/C13H22FNO2/c1-3-13(2,14)9-5-4-6-10-15-11(16)7-8-12(15)17/h3-10H2,1-2H3 |
| InChIKey | ZCLGEGNYVXKTFG-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.32 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|