C23H41N3O4 — CID 176877362
6-(3-tert-butyl-2,5-dioxopyrrolidin-1-yl)-N-[2-[2,2-dimethylpropanoyl(methyl)amino]ethyl]-N-methylhexanamide (PubChem CID 176877362) has the molecular formula C23H41N3O4 and a molecular weight of 423.60 g/mol. Its IUPAC name is 6-(3-tert-butyl-2,5-dioxopyrrolidin-1-yl)-N-[2-[2,2-dimethylpropanoyl(methyl)amino]ethyl]-N-methylhexanamide.
| Compound Name | 6-(3-tert-butyl-2,5-dioxopyrrolidin-1-yl)-N-[2-[2,2-dimethylpropanoyl(methyl)amino]ethyl]-N-methylhexanamide |
|---|---|
| PubChem CID | 176877362 |
| Molecular Formula | C23H41N3O4 |
| Molecular Weight | 423.60 g/mol |
| Exact Mass | 423.31 |
| IUPAC Name | 6-(3-tert-butyl-2,5-dioxopyrrolidin-1-yl)-N-[2-[2,2-dimethylpropanoyl(methyl)amino]ethyl]-N-methylhexanamide |
| SMILES | CN(CCN(C)C(=O)C(C)(C)C)C(=O)CCCCCN1C(=O)CC(C(C)(C)C)C1=O |
| InChI | InChI=1S/C23H41N3O4/c1-22(2,3)17-16-19(28)26(20(17)29)13-11-9-10-12-18(27)24(7)14-15-25(8)21(30)23(4,5)6/h17H,9-16H2,1-8H3 |
| InChIKey | PIYXVDFTDMQXCU-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 78.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.60 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|