C23H40N2O3 — CID 134402061
3-tert-butyl-1-[7-[(3R)-3-tert-butylpyrrolidin-1-yl]-7-oxoheptyl]pyrrolidine-2,5-dione (PubChem CID 134402061) has the molecular formula C23H40N2O3 and a molecular weight of 392.58 g/mol. Its IUPAC name is 3-tert-butyl-1-[7-[(3R)-3-tert-butylpyrrolidin-1-yl]-7-oxoheptyl]pyrrolidine-2,5-dione.
| Compound Name | 3-tert-butyl-1-[7-[(3R)-3-tert-butylpyrrolidin-1-yl]-7-oxoheptyl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 134402061 |
| Molecular Formula | C23H40N2O3 |
| Molecular Weight | 392.58 g/mol |
| Exact Mass | 392.30 |
| IUPAC Name | 3-tert-butyl-1-[7-[(3R)-3-tert-butylpyrrolidin-1-yl]-7-oxoheptyl]pyrrolidine-2,5-dione |
| SMILES | CC(C)(C)C1CC(=O)N(CCCCCCC(=O)N2CC[C@H](C(C)(C)C)C2)C1=O |
| InChI | InChI=1S/C23H40N2O3/c1-22(2,3)17-12-14-24(16-17)19(26)11-9-7-8-10-13-25-20(27)15-18(21(25)28)23(4,5)6/h17-18H,7-16H2,1-6H3/t17-,18?/m0/s1 |
| InChIKey | FVLRUYOAOTXLHU-ZENAZSQFSA-N |
| XLogP | 4.25 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.58 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|