C26H42N2O3 — CID 157058851
1-(3-tert-butylpyrrolidin-1-yl)-13-(2-methylidene-5-oxopyrrol-1-yl)tridecane-1,8-dione (PubChem CID 157058851) has the molecular formula C26H42N2O3 and a molecular weight of 430.63 g/mol. Its IUPAC name is 1-(3-tert-butylpyrrolidin-1-yl)-13-(2-methylidene-5-oxopyrrol-1-yl)tridecane-1,8-dione.
| Compound Name | 1-(3-tert-butylpyrrolidin-1-yl)-13-(2-methylidene-5-oxopyrrol-1-yl)tridecane-1,8-dione |
|---|---|
| PubChem CID | 157058851 |
| Molecular Formula | C26H42N2O3 |
| Molecular Weight | 430.63 g/mol |
| Exact Mass | 430.32 |
| IUPAC Name | 1-(3-tert-butylpyrrolidin-1-yl)-13-(2-methylidene-5-oxopyrrol-1-yl)tridecane-1,8-dione |
| SMILES | C=C1C=CC(=O)N1CCCCCC(=O)CCCCCCC(=O)N1CCC(C(C)(C)C)C1 |
| InChI | InChI=1S/C26H42N2O3/c1-21-15-16-25(31)28(21)18-11-7-9-13-23(29)12-8-5-6-10-14-24(30)27-19-17-22(20-27)26(2,3)4/h15-16,22H,1,5-14,17-20H2,2-4H3 |
| InChIKey | OPTYJZIJDAACIT-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.63 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|