C17H28N2O3 — CID 145076820
ethane;1-[6-(3-methylpyrrolidin-1-yl)-6-oxohexyl]pyrrole-2,5-dione (PubChem CID 145076820) has the molecular formula C17H28N2O3 and a molecular weight of 308.42 g/mol. Its IUPAC name is ethane;1-[6-(3-methylpyrrolidin-1-yl)-6-oxohexyl]pyrrole-2,5-dione.
| Compound Name | ethane;1-[6-(3-methylpyrrolidin-1-yl)-6-oxohexyl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 145076820 |
| Molecular Formula | C17H28N2O3 |
| Molecular Weight | 308.42 g/mol |
| Exact Mass | 308.21 |
| IUPAC Name | ethane;1-[6-(3-methylpyrrolidin-1-yl)-6-oxohexyl]pyrrole-2,5-dione |
| SMILES | CC.CC1CCN(C(=O)CCCCCN2C(=O)C=CC2=O)C1 |
| InChI | InChI=1S/C15H22N2O3.C2H6/c1-12-8-10-16(11-12)13(18)5-3-2-4-9-17-14(19)6-7-15(17)20;1-2/h6-7,12H,2-5,8-11H2,1H3;1-2H3 |
| InChIKey | YLJZIKYCURLORK-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.42 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|