C22H38N2O3 — CID 134402052
3-tert-butyl-1-[6-[(3R)-3-tert-butylpyrrolidin-1-yl]-6-oxohexyl]pyrrolidine-2,5-dione (PubChem CID 134402052) has the molecular formula C22H38N2O3 and a molecular weight of 378.56 g/mol. Its IUPAC name is 3-tert-butyl-1-[6-[(3R)-3-tert-butylpyrrolidin-1-yl]-6-oxohexyl]pyrrolidine-2,5-dione.
| Compound Name | 3-tert-butyl-1-[6-[(3R)-3-tert-butylpyrrolidin-1-yl]-6-oxohexyl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 134402052 |
| Molecular Formula | C22H38N2O3 |
| Molecular Weight | 378.56 g/mol |
| Exact Mass | 378.29 |
| IUPAC Name | 3-tert-butyl-1-[6-[(3R)-3-tert-butylpyrrolidin-1-yl]-6-oxohexyl]pyrrolidine-2,5-dione |
| SMILES | CC(C)(C)C1CC(=O)N(CCCCCC(=O)N2CC[C@H](C(C)(C)C)C2)C1=O |
| InChI | InChI=1S/C22H38N2O3/c1-21(2,3)16-11-13-23(15-16)18(25)10-8-7-9-12-24-19(26)14-17(20(24)27)22(4,5)6/h16-17H,7-15H2,1-6H3/t16-,17?/m0/s1 |
| InChIKey | COZPKUGJIXAYLH-BHWOMJMDSA-N |
| XLogP | 3.86 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.56 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|