C15H25NO3 — CID 58051575
3-tert-butyl-1-(3-oxoheptyl)pyrrolidine-2,5-dione (PubChem CID 58051575) has the molecular formula C15H25NO3 and a molecular weight of 267.37 g/mol. Its IUPAC name is 3-tert-butyl-1-(3-oxoheptyl)pyrrolidine-2,5-dione.
| Compound Name | 3-tert-butyl-1-(3-oxoheptyl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 58051575 |
| Molecular Formula | C15H25NO3 |
| Molecular Weight | 267.37 g/mol |
| Exact Mass | 267.18 |
| IUPAC Name | 3-tert-butyl-1-(3-oxoheptyl)pyrrolidine-2,5-dione |
| SMILES | CCCCC(=O)CCN1C(=O)CC(C(C)(C)C)C1=O |
| InChI | InChI=1S/C15H25NO3/c1-5-6-7-11(17)8-9-16-13(18)10-12(14(16)19)15(2,3)4/h12H,5-10H2,1-4H3 |
| InChIKey | FUDKGFUMZHQTNN-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.37 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|