C11H17BN2O3 — CID 174135070
CID 174135070 (PubChem CID 174135070) has the molecular formula C11H17BN2O3 and a molecular weight of 236.08 g/mol.
| Compound Name | CID 174135070 |
|---|---|
| PubChem CID | 174135070 |
| Molecular Formula | C11H17BN2O3 |
| Molecular Weight | 236.08 g/mol |
| Exact Mass | 236.13 |
| IUPAC Name | — |
| SMILES | [B]C(=O)CNCN1C(=O)CC(C(C)(C)C)C1=O |
| InChI | InChI=1S/C11H17BN2O3/c1-11(2,3)7-4-9(16)14(10(7)17)6-13-5-8(12)15/h7,13H,4-6H2,1-3H3 |
| InChIKey | DRUPLFSRHZOAEE-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.08 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|