C18H30N2O3 — CID 170672640
4-[(3-tert-butyl-2,5-dioxopyrrolidin-1-yl)methyl]-N-ethylcyclohexane-1-carboxamide (PubChem CID 170672640) has the molecular formula C18H30N2O3 and a molecular weight of 322.45 g/mol. Its IUPAC name is 4-[(3-tert-butyl-2,5-dioxopyrrolidin-1-yl)methyl]-N-ethylcyclohexane-1-carboxamide.
| Compound Name | 4-[(3-tert-butyl-2,5-dioxopyrrolidin-1-yl)methyl]-N-ethylcyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 170672640 |
| Molecular Formula | C18H30N2O3 |
| Molecular Weight | 322.45 g/mol |
| Exact Mass | 322.23 |
| IUPAC Name | 4-[(3-tert-butyl-2,5-dioxopyrrolidin-1-yl)methyl]-N-ethylcyclohexane-1-carboxamide |
| SMILES | CCNC(=O)C1CCC(CN2C(=O)CC(C(C)(C)C)C2=O)CC1 |
| InChI | InChI=1S/C18H30N2O3/c1-5-19-16(22)13-8-6-12(7-9-13)11-20-15(21)10-14(17(20)23)18(2,3)4/h12-14H,5-11H2,1-4H3,(H,19,22) |
| InChIKey | SUOQSBSXBKHQPR-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.45 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|