C21H33NO6S2 — CID 155206012
[2-(disulfanyl)-2-methylpropanoyl]oxymethyl 4-[(3-tert-butyl-2,5-dioxopyrrolidin-1-yl)methyl]cyclohexane-1-carboxylate (PubChem CID 155206012) has the molecular formula C21H33NO6S2 and a molecular weight of 459.63 g/mol. Its IUPAC name is [2-(disulfanyl)-2-methylpropanoyl]oxymethyl 4-[(3-tert-butyl-2,5-dioxopyrrolidin-1-yl)methyl]cyclohexane-1-carboxylate.
| Compound Name | [2-(disulfanyl)-2-methylpropanoyl]oxymethyl 4-[(3-tert-butyl-2,5-dioxopyrrolidin-1-yl)methyl]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 155206012 |
| Molecular Formula | C21H33NO6S2 |
| Molecular Weight | 459.63 g/mol |
| Exact Mass | 459.17 |
| IUPAC Name | [2-(disulfanyl)-2-methylpropanoyl]oxymethyl 4-[(3-tert-butyl-2,5-dioxopyrrolidin-1-yl)methyl]cyclohexane-1-carboxylate |
| SMILES | CC(C)(SS)C(=O)OCOC(=O)C1CCC(CN2C(=O)CC(C(C)(C)C)C2=O)CC1 |
| InChI | InChI=1S/C21H33NO6S2/c1-20(2,3)15-10-16(23)22(17(15)24)11-13-6-8-14(9-7-13)18(25)27-12-28-19(26)21(4,5)30-29/h13-15,29H,6-12H2,1-5H3 |
| InChIKey | RLTBDZPESPUGJV-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 89.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.63 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|