C15H25NO4 — CID 145431015
ethane;4-[(3-methyl-2,5-dioxopyrrolidin-1-yl)methyl]cyclohexane-1-carboxylic acid (PubChem CID 145431015) has the molecular formula C15H25NO4 and a molecular weight of 283.37 g/mol. Its IUPAC name is ethane;4-[(3-methyl-2,5-dioxopyrrolidin-1-yl)methyl]cyclohexane-1-carboxylic acid.
| Compound Name | ethane;4-[(3-methyl-2,5-dioxopyrrolidin-1-yl)methyl]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 145431015 |
| Molecular Formula | C15H25NO4 |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.18 |
| IUPAC Name | ethane;4-[(3-methyl-2,5-dioxopyrrolidin-1-yl)methyl]cyclohexane-1-carboxylic acid |
| SMILES | CC.CC1CC(=O)N(CC2CCC(C(=O)O)CC2)C1=O |
| InChI | InChI=1S/C13H19NO4.C2H6/c1-8-6-11(15)14(12(8)16)7-9-2-4-10(5-3-9)13(17)18;1-2/h8-10H,2-7H2,1H3,(H,17,18);1-2H3 |
| InChIKey | CGCUYHAOAIWWDO-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|