C26H39NO6 — CID 159894172
1-[(4-acetylcyclohexyl)methyl]-3-methylpyrrolidine-2,5-dione;4-methyl-2-(5-oxohexyl)cyclopentane-1,3-dione (PubChem CID 159894172) has the molecular formula C26H39NO6 and a molecular weight of 461.60 g/mol. Its IUPAC name is 1-[(4-acetylcyclohexyl)methyl]-3-methylpyrrolidine-2,5-dione;4-methyl-2-(5-oxohexyl)cyclopentane-1,3-dione.
| Compound Name | 1-[(4-acetylcyclohexyl)methyl]-3-methylpyrrolidine-2,5-dione;4-methyl-2-(5-oxohexyl)cyclopentane-1,3-dione |
|---|---|
| PubChem CID | 159894172 |
| Molecular Formula | C26H39NO6 |
| Molecular Weight | 461.60 g/mol |
| Exact Mass | 461.28 |
| IUPAC Name | 1-[(4-acetylcyclohexyl)methyl]-3-methylpyrrolidine-2,5-dione;4-methyl-2-(5-oxohexyl)cyclopentane-1,3-dione |
| SMILES | CC(=O)C1CCC(CN2C(=O)CC(C)C2=O)CC1.CC(=O)CCCCC1C(=O)CC(C)C1=O |
| InChI | InChI=1S/C14H21NO3.C12H18O3/c1-9-7-13(17)15(14(9)18)8-11-3-5-12(6-4-11)10(2)16;1-8-7-11(14)10(12(8)15)6-4-3-5-9(2)13/h9,11-12H,3-8H2,1-2H3;8,10H,3-7H2,1-2H3 |
| InChIKey | NVDDSNVWUQINJW-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 105.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.60 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|