C16H23NO4S — CID 160707921
1-[(4-acetylcyclohexyl)methyl]-3-(3-deuterio-3-oxopropyl)sulfanylpyrrolidine-2,5-dione (PubChem CID 160707921) has the molecular formula C16H23NO4S and a molecular weight of 326.44 g/mol. Its IUPAC name is 1-[(4-acetylcyclohexyl)methyl]-3-(3-deuterio-3-oxopropyl)sulfanylpyrrolidine-2,5-dione.
| Compound Name | 1-[(4-acetylcyclohexyl)methyl]-3-(3-deuterio-3-oxopropyl)sulfanylpyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 160707921 |
| Molecular Formula | C16H23NO4S |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.14 |
| IUPAC Name | 1-[(4-acetylcyclohexyl)methyl]-3-(3-deuterio-3-oxopropyl)sulfanylpyrrolidine-2,5-dione |
| SMILES | [2H]C(=O)CCSC1CC(=O)N(CC2CCC(C(C)=O)CC2)C1=O |
| InChI | InChI=1S/C16H23NO4S/c1-11(19)13-5-3-12(4-6-13)10-17-15(20)9-14(16(17)21)22-8-2-7-18/h7,12-14H,2-6,8-10H2,1H3/i7D |
| InChIKey | RRLXZUZSXGYYQQ-WHRKIXHSSA-N |
| XLogP | 1.83 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|