C19H33N2O4PS — CID 126556143
N-(2-tert-butylphosphanylethyl)-6-[3-(3-deuterio-3-oxopropyl)sulfanyl-2,5-dioxopyrrolidin-1-yl]hexanamide (PubChem CID 126556143) has the molecular formula C19H33N2O4PS and a molecular weight of 417.53 g/mol. Its IUPAC name is N-(2-tert-butylphosphanylethyl)-6-[3-(3-deuterio-3-oxopropyl)sulfanyl-2,5-dioxopyrrolidin-1-yl]hexanamide.
| Compound Name | N-(2-tert-butylphosphanylethyl)-6-[3-(3-deuterio-3-oxopropyl)sulfanyl-2,5-dioxopyrrolidin-1-yl]hexanamide |
|---|---|
| PubChem CID | 126556143 |
| Molecular Formula | C19H33N2O4PS |
| Molecular Weight | 417.53 g/mol |
| Exact Mass | 417.20 |
| IUPAC Name | N-(2-tert-butylphosphanylethyl)-6-[3-(3-deuterio-3-oxopropyl)sulfanyl-2,5-dioxopyrrolidin-1-yl]hexanamide |
| SMILES | [2H]C(=O)CCSC1CC(=O)N(CCCCCC(=O)NCCPC(C)(C)C)C1=O |
| InChI | InChI=1S/C19H33N2O4PS/c1-19(2,3)26-12-9-20-16(23)8-5-4-6-10-21-17(24)14-15(18(21)25)27-13-7-11-22/h11,15,26H,4-10,12-14H2,1-3H3,(H,20,23)/i11D |
| InChIKey | CRIUVBAQSVMHFY-WORMITQPSA-N |
| XLogP | 2.59 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.53 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|