C19H34N2O5S2 — CID 118360441
6-(2,5-dioxo-3-propan-2-ylsulfanylpyrrolidin-1-yl)-N-[2-(2-methylpropylsulfonyl)ethyl]hexanamide (PubChem CID 118360441) has the molecular formula C19H34N2O5S2 and a molecular weight of 434.62 g/mol. Its IUPAC name is 6-(2,5-dioxo-3-propan-2-ylsulfanylpyrrolidin-1-yl)-N-[2-(2-methylpropylsulfonyl)ethyl]hexanamide.
| Compound Name | 6-(2,5-dioxo-3-propan-2-ylsulfanylpyrrolidin-1-yl)-N-[2-(2-methylpropylsulfonyl)ethyl]hexanamide |
|---|---|
| PubChem CID | 118360441 |
| Molecular Formula | C19H34N2O5S2 |
| Molecular Weight | 434.62 g/mol |
| Exact Mass | 434.19 |
| IUPAC Name | 6-(2,5-dioxo-3-propan-2-ylsulfanylpyrrolidin-1-yl)-N-[2-(2-methylpropylsulfonyl)ethyl]hexanamide |
| SMILES | CC(C)CS(=O)(=O)CCNC(=O)CCCCCN1C(=O)CC(SC(C)C)C1=O |
| InChI | InChI=1S/C19H34N2O5S2/c1-14(2)13-28(25,26)11-9-20-17(22)8-6-5-7-10-21-18(23)12-16(19(21)24)27-15(3)4/h14-16H,5-13H2,1-4H3,(H,20,22) |
| InChIKey | UWNKRCUYCRQPNJ-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.62 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|