C36H68N2O3S — CID 154980644
6-(2,5-dioxo-3-undecan-6-ylsulfanylpyrrolidin-1-yl)-N-pentadecan-8-ylhexanamide (PubChem CID 154980644) has the molecular formula C36H68N2O3S and a molecular weight of 609.02 g/mol. Its IUPAC name is 6-(2,5-dioxo-3-undecan-6-ylsulfanylpyrrolidin-1-yl)-N-pentadecan-8-ylhexanamide.
| Compound Name | 6-(2,5-dioxo-3-undecan-6-ylsulfanylpyrrolidin-1-yl)-N-pentadecan-8-ylhexanamide |
|---|---|
| PubChem CID | 154980644 |
| Molecular Formula | C36H68N2O3S |
| Molecular Weight | 609.02 g/mol |
| Exact Mass | 608.50 |
| IUPAC Name | 6-(2,5-dioxo-3-undecan-6-ylsulfanylpyrrolidin-1-yl)-N-pentadecan-8-ylhexanamide |
| SMILES | CCCCCCCC(CCCCCCC)NC(=O)CCCCCN1C(=O)CC(SC(CCCCC)CCCCC)C1=O |
| InChI | InChI=1S/C36H68N2O3S/c1-5-9-13-15-20-24-31(25-21-16-14-10-6-2)37-34(39)28-22-17-23-29-38-35(40)30-33(36(38)41)42-32(26-18-11-7-3)27-19-12-8-4/h31-33H,5-30H2,1-4H3,(H,37,39) |
| InChIKey | YLRORZPHZRVFRF-UHFFFAOYSA-N |
| XLogP | 10.14 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.02 |
| LogP ≤ 5 | 10.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|