C19H31N3O5S — CID 172565705
2-[3-(3-hexan-2-ylsulfanyl-2,5-dioxopyrrolidin-1-yl)propanoylamino]-N-[(2S)-1-oxopropan-2-yl]propanamide (PubChem CID 172565705) has the molecular formula C19H31N3O5S and a molecular weight of 413.54 g/mol. Its IUPAC name is 2-[3-(3-hexan-2-ylsulfanyl-2,5-dioxopyrrolidin-1-yl)propanoylamino]-N-[(2S)-1-oxopropan-2-yl]propanamide.
| Compound Name | 2-[3-(3-hexan-2-ylsulfanyl-2,5-dioxopyrrolidin-1-yl)propanoylamino]-N-[(2S)-1-oxopropan-2-yl]propanamide |
|---|---|
| PubChem CID | 172565705 |
| Molecular Formula | C19H31N3O5S |
| Molecular Weight | 413.54 g/mol |
| Exact Mass | 413.20 |
| IUPAC Name | 2-[3-(3-hexan-2-ylsulfanyl-2,5-dioxopyrrolidin-1-yl)propanoylamino]-N-[(2S)-1-oxopropan-2-yl]propanamide |
| SMILES | CCCCC(C)SC1CC(=O)N(CCC(=O)NC(C)C(=O)N[C@@H](C)C=O)C1=O |
| InChI | InChI=1S/C19H31N3O5S/c1-5-6-7-13(3)28-15-10-17(25)22(19(15)27)9-8-16(24)21-14(4)18(26)20-12(2)11-23/h11-15H,5-10H2,1-4H3,(H,20,26)(H,21,24)/t12-,13?,14?,15?/m0/s1 |
| InChIKey | SSQRYEMKZRSVNE-NAOUJUTFSA-N |
| XLogP | 1.02 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.54 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|