C27H44BN5O7S2 — CID 166157798
CID 166157798 (PubChem CID 166157798) has the molecular formula C27H44BN5O7S2 and a molecular weight of 625.62 g/mol.
| Compound Name | CID 166157798 |
|---|---|
| PubChem CID | 166157798 |
| Molecular Formula | C27H44BN5O7S2 |
| Molecular Weight | 625.62 g/mol |
| Exact Mass | 625.28 |
| IUPAC Name | — |
| SMILES | [B]C(=O)CCCCCSCNC(=O)CNC(=O)CNC(=O)CNC(=O)CCCCCN1C(=O)CC(SC(C)CC)C1=O |
| InChI | InChI=1S/C27H44BN5O7S2/c1-3-19(2)42-20-14-26(39)33(27(20)40)12-8-4-7-11-22(35)29-15-23(36)30-16-24(37)31-17-25(38)32-18-41-13-9-5-6-10-21(28)34/h19-20H,3-18H2,1-2H3,(H,29,35)(H,30,36)(H,31,37)(H,32,38) |
| InChIKey | WZJOVXCIYVWBKL-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 170.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.62 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|