C14H22INO3S — CID 126491665
3-(1-iodopropylsulfanyl)-1-(6-oxoheptyl)pyrrolidine-2,5-dione (PubChem CID 126491665) has the molecular formula C14H22INO3S and a molecular weight of 411.31 g/mol. Its IUPAC name is 3-(1-iodopropylsulfanyl)-1-(6-oxoheptyl)pyrrolidine-2,5-dione.
| Compound Name | 3-(1-iodopropylsulfanyl)-1-(6-oxoheptyl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 126491665 |
| Molecular Formula | C14H22INO3S |
| Molecular Weight | 411.31 g/mol |
| Exact Mass | 411.04 |
| IUPAC Name | 3-(1-iodopropylsulfanyl)-1-(6-oxoheptyl)pyrrolidine-2,5-dione |
| SMILES | CCC(I)SC1CC(=O)N(CCCCCC(C)=O)C1=O |
| InChI | InChI=1S/C14H22INO3S/c1-3-12(15)20-11-9-13(18)16(14(11)19)8-6-4-5-7-10(2)17/h11-12H,3-9H2,1-2H3 |
| InChIKey | FCWBTWHIEDJSLY-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.31 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|