C19H33N3O4S — CID 143795455
N-(1-amino-3-methyl-1-oxobutan-2-yl)-6-(2,5-dioxo-3-propan-2-ylsulfanylpyrrolidin-1-yl)-N-methylhexanamide (PubChem CID 143795455) has the molecular formula C19H33N3O4S and a molecular weight of 399.56 g/mol. Its IUPAC name is N-(1-amino-3-methyl-1-oxobutan-2-yl)-6-(2,5-dioxo-3-propan-2-ylsulfanylpyrrolidin-1-yl)-N-methylhexanamide.
| Compound Name | N-(1-amino-3-methyl-1-oxobutan-2-yl)-6-(2,5-dioxo-3-propan-2-ylsulfanylpyrrolidin-1-yl)-N-methylhexanamide |
|---|---|
| PubChem CID | 143795455 |
| Molecular Formula | C19H33N3O4S |
| Molecular Weight | 399.56 g/mol |
| Exact Mass | 399.22 |
| IUPAC Name | N-(1-amino-3-methyl-1-oxobutan-2-yl)-6-(2,5-dioxo-3-propan-2-ylsulfanylpyrrolidin-1-yl)-N-methylhexanamide |
| SMILES | CC(C)SC1CC(=O)N(CCCCCC(=O)N(C)C(C(N)=O)C(C)C)C1=O |
| InChI | InChI=1S/C19H33N3O4S/c1-12(2)17(18(20)25)21(5)15(23)9-7-6-8-10-22-16(24)11-14(19(22)26)27-13(3)4/h12-14,17H,6-11H2,1-5H3,(H2,20,25) |
| InChIKey | LWALQVIYQWEUMX-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 100.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.56 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|