C16H25NO3S — CID 134491687
1-[(4-acetylcyclohexyl)methyl]-3-propan-2-ylsulfanylpyrrolidine-2,5-dione (PubChem CID 134491687) has the molecular formula C16H25NO3S and a molecular weight of 311.45 g/mol. Its IUPAC name is 1-[(4-acetylcyclohexyl)methyl]-3-propan-2-ylsulfanylpyrrolidine-2,5-dione.
| Compound Name | 1-[(4-acetylcyclohexyl)methyl]-3-propan-2-ylsulfanylpyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 134491687 |
| Molecular Formula | C16H25NO3S |
| Molecular Weight | 311.45 g/mol |
| Exact Mass | 311.16 |
| IUPAC Name | 1-[(4-acetylcyclohexyl)methyl]-3-propan-2-ylsulfanylpyrrolidine-2,5-dione |
| SMILES | CC(=O)C1CCC(CN2C(=O)CC(SC(C)C)C2=O)CC1 |
| InChI | InChI=1S/C16H25NO3S/c1-10(2)21-14-8-15(19)17(16(14)20)9-12-4-6-13(7-5-12)11(3)18/h10,12-14H,4-9H2,1-3H3 |
| InChIKey | COYSIMHFOWJKJS-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.45 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|