C9H13NO4S — CID 166731682
(2,5-dioxo-3-propan-2-ylsulfanylpyrrolidin-1-yl) acetate (PubChem CID 166731682) has the molecular formula C9H13NO4S and a molecular weight of 231.27 g/mol. Its IUPAC name is (2,5-dioxo-3-propan-2-ylsulfanylpyrrolidin-1-yl) acetate.
| Compound Name | (2,5-dioxo-3-propan-2-ylsulfanylpyrrolidin-1-yl) acetate |
|---|---|
| PubChem CID | 166731682 |
| Molecular Formula | C9H13NO4S |
| Molecular Weight | 231.27 g/mol |
| Exact Mass | 231.06 |
| IUPAC Name | (2,5-dioxo-3-propan-2-ylsulfanylpyrrolidin-1-yl) acetate |
| SMILES | CC(=O)ON1C(=O)CC(SC(C)C)C1=O |
| InChI | InChI=1S/C9H13NO4S/c1-5(2)15-7-4-8(12)10(9(7)13)14-6(3)11/h5,7H,4H2,1-3H3 |
| InChIKey | SZPPAGFQJBUAJE-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.27 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|