C12H21NO4S3 — CID 142806175
[3-[3-(disulfanyl)propylsulfanyl]-2,5-dioxopyrrolidin-1-yl] acetate;propane (PubChem CID 142806175) has the molecular formula C12H21NO4S3 and a molecular weight of 339.50 g/mol. Its IUPAC name is [3-[3-(disulfanyl)propylsulfanyl]-2,5-dioxopyrrolidin-1-yl] acetate;propane.
| Compound Name | [3-[3-(disulfanyl)propylsulfanyl]-2,5-dioxopyrrolidin-1-yl] acetate;propane |
|---|---|
| PubChem CID | 142806175 |
| Molecular Formula | C12H21NO4S3 |
| Molecular Weight | 339.50 g/mol |
| Exact Mass | 339.06 |
| IUPAC Name | [3-[3-(disulfanyl)propylsulfanyl]-2,5-dioxopyrrolidin-1-yl] acetate;propane |
| SMILES | CC(=O)ON1C(=O)CC(SCCCSS)C1=O.CCC |
| InChI | InChI=1S/C9H13NO4S3.C3H8/c1-6(11)14-10-8(12)5-7(9(10)13)16-3-2-4-17-15;1-3-2/h7,15H,2-5H2,1H3;3H2,1-2H3 |
| InChIKey | PIZNLZKGCLORIH-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 63.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.50 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|