C18H28N2O4S3 — CID 143475351
acetylene;[3-[3-(methyliminomethyldisulfanyl)propylsulfanyl]-2,5-dioxopyrrolidin-1-yl] acetate;(Z)-pent-2-ene (PubChem CID 143475351) has the molecular formula C18H28N2O4S3 and a molecular weight of 432.63 g/mol. Its IUPAC name is acetylene;[3-[3-(methyliminomethyldisulfanyl)propylsulfanyl]-2,5-dioxopyrrolidin-1-yl] acetate;(Z)-pent-2-ene.
| Compound Name | acetylene;[3-[3-(methyliminomethyldisulfanyl)propylsulfanyl]-2,5-dioxopyrrolidin-1-yl] acetate;(Z)-pent-2-ene |
|---|---|
| PubChem CID | 143475351 |
| Molecular Formula | C18H28N2O4S3 |
| Molecular Weight | 432.63 g/mol |
| Exact Mass | 432.12 |
| IUPAC Name | acetylene;[3-[3-(methyliminomethyldisulfanyl)propylsulfanyl]-2,5-dioxopyrrolidin-1-yl] acetate;(Z)-pent-2-ene |
| SMILES | C#C.C/C=C\CC.C/N=C/SSCCCSC1CC(=O)N(OC(C)=O)C1=O |
| InChI | InChI=1S/C11H16N2O4S3.C5H10.C2H2/c1-8(14)17-13-10(15)6-9(11(13)16)18-4-3-5-19-20-7-12-2;1-3-5-4-2;1-2/h7,9H,3-6H2,1-2H3;3,5H,4H2,1-2H3;1-2H/b12-7+;5-3-; |
| InChIKey | KMNNPGKLXRWMBK-XZGCOSEUSA-N |
| XLogP | 3.98 |
| TPSA | 76.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.63 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|