C8H13CeNO3S — CID 160565478
cerium;1-methoxy-3-propylsulfanylpyrrolidine-2,5-dione (PubChem CID 160565478) has the molecular formula C8H13CeNO3S and a molecular weight of 343.38 g/mol. Its IUPAC name is cerium;1-methoxy-3-propylsulfanylpyrrolidine-2,5-dione.
| Compound Name | cerium;1-methoxy-3-propylsulfanylpyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 160565478 |
| Molecular Formula | C8H13CeNO3S |
| Molecular Weight | 343.38 g/mol |
| Exact Mass | 342.97 |
| IUPAC Name | cerium;1-methoxy-3-propylsulfanylpyrrolidine-2,5-dione |
| SMILES | CCCSC1CC(=O)N(OC)C1=O.[Ce] |
| InChI | InChI=1S/C8H13NO3S.Ce/c1-3-4-13-6-5-7(10)9(12-2)8(6)11;/h6H,3-5H2,1-2H3; |
| InChIKey | QZWBUAHGXPCXNK-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.38 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|