C15H23NO6S2 — CID 142195846
[(2E,4E)-5-(2,5-dioxo-3-propylsulfanylpyrrolidin-1-yl)hepta-2,4-dien-3-yl] methyl sulfate (PubChem CID 142195846) has the molecular formula C15H23NO6S2 and a molecular weight of 377.48 g/mol. Its IUPAC name is [(2E,4E)-5-(2,5-dioxo-3-propylsulfanylpyrrolidin-1-yl)hepta-2,4-dien-3-yl] methyl sulfate.
| Compound Name | [(2E,4E)-5-(2,5-dioxo-3-propylsulfanylpyrrolidin-1-yl)hepta-2,4-dien-3-yl] methyl sulfate |
|---|---|
| PubChem CID | 142195846 |
| Molecular Formula | C15H23NO6S2 |
| Molecular Weight | 377.48 g/mol |
| Exact Mass | 377.10 |
| IUPAC Name | [(2E,4E)-5-(2,5-dioxo-3-propylsulfanylpyrrolidin-1-yl)hepta-2,4-dien-3-yl] methyl sulfate |
| SMILES | C/C=C(\C=C(/CC)N1C(=O)CC(SCCC)C1=O)OS(=O)(=O)OC |
| InChI | InChI=1S/C15H23NO6S2/c1-5-8-23-13-10-14(17)16(15(13)18)11(6-2)9-12(7-3)22-24(19,20)21-4/h7,9,13H,5-6,8,10H2,1-4H3/b11-9+,12-7+ |
| InChIKey | VLYNORMYTBBNBG-DMXQEXBGSA-N |
| XLogP | 2.36 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.48 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|