C24H41NO4S — CID 70590841
3-(2-hydroxyethylsulfanyl)-1-octadec-9-enoylpyrrolidine-2,5-dione (PubChem CID 70590841) has the molecular formula C24H41NO4S and a molecular weight of 439.66 g/mol. Its IUPAC name is 3-(2-hydroxyethylsulfanyl)-1-octadec-9-enoylpyrrolidine-2,5-dione.
| Compound Name | 3-(2-hydroxyethylsulfanyl)-1-octadec-9-enoylpyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 70590841 |
| Molecular Formula | C24H41NO4S |
| Molecular Weight | 439.66 g/mol |
| Exact Mass | 439.28 |
| IUPAC Name | 3-(2-hydroxyethylsulfanyl)-1-octadec-9-enoylpyrrolidine-2,5-dione |
| SMILES | CCCCCCCCC=CCCCCCCCC(=O)N1C(=O)CC(SCCO)C1=O |
| InChI | InChI=1S/C24H41NO4S/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-22(27)25-23(28)20-21(24(25)29)30-19-18-26/h9-10,21,26H,2-8,11-20H2,1H3 |
| InChIKey | OCNYJIZKZRFMKF-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.66 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|