C15H17NO4S — CID 2437160
methyl 3-[(3S)-1-(4-methylphenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylpropanoate (PubChem CID 2437160) has the molecular formula C15H17NO4S and a molecular weight of 307.37 g/mol. Its IUPAC name is methyl 3-[(3S)-1-(4-methylphenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylpropanoate.
| Compound Name | methyl 3-[(3S)-1-(4-methylphenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylpropanoate |
|---|---|
| PubChem CID | 2437160 |
| Molecular Formula | C15H17NO4S |
| Molecular Weight | 307.37 g/mol |
| Exact Mass | 307.09 |
| IUPAC Name | methyl 3-[(3S)-1-(4-methylphenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylpropanoate |
| SMILES | COC(=O)CCS[C@H]1CC(=O)N(c2ccc(C)cc2)C1=O |
| InChI | InChI=1S/C15H17NO4S/c1-10-3-5-11(6-4-10)16-13(17)9-12(15(16)19)21-8-7-14(18)20-2/h3-6,12H,7-9H2,1-2H3/t12-/m0/s1 |
| InChIKey | SMLQFNBAIXMNIK-LBPRGKRZSA-N |
| XLogP | 1.92 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.37 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|