C9H13NO4S2 — CID 178057653
[3-(methyldisulfanyl)-2,5-dioxopyrrolidin-1-yl] 2-methylpropanoate (PubChem CID 178057653) has the molecular formula C9H13NO4S2 and a molecular weight of 263.34 g/mol. Its IUPAC name is [3-(methyldisulfanyl)-2,5-dioxopyrrolidin-1-yl] 2-methylpropanoate.
| Compound Name | [3-(methyldisulfanyl)-2,5-dioxopyrrolidin-1-yl] 2-methylpropanoate |
|---|---|
| PubChem CID | 178057653 |
| Molecular Formula | C9H13NO4S2 |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.03 |
| IUPAC Name | [3-(methyldisulfanyl)-2,5-dioxopyrrolidin-1-yl] 2-methylpropanoate |
| SMILES | CSSC1CC(=O)N(OC(=O)C(C)C)C1=O |
| InChI | InChI=1S/C9H13NO4S2/c1-5(2)9(13)14-10-7(11)4-6(8(10)12)16-15-3/h5-6H,4H2,1-3H3 |
| InChIKey | QPKANOZHOLJYKQ-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|