C17H32N3O6S+ — CID 178019186
[acetyloxy(dimethylamino)methylidene]-dimethylazanium;(2,5-dioxo-3-sulfanylpyrrolidin-1-yl) 2-methylpropanoate;ethane (PubChem CID 178019186) has the molecular formula C17H32N3O6S+ and a molecular weight of 406.53 g/mol. Its IUPAC name is [acetyloxy(dimethylamino)methylidene]-dimethylazanium;(2,5-dioxo-3-sulfanylpyrrolidin-1-yl) 2-methylpropanoate;ethane.
| Compound Name | [acetyloxy(dimethylamino)methylidene]-dimethylazanium;(2,5-dioxo-3-sulfanylpyrrolidin-1-yl) 2-methylpropanoate;ethane |
|---|---|
| PubChem CID | 178019186 |
| Molecular Formula | C17H32N3O6S+ |
| Molecular Weight | 406.53 g/mol |
| Exact Mass | 406.20 |
| IUPAC Name | [acetyloxy(dimethylamino)methylidene]-dimethylazanium;(2,5-dioxo-3-sulfanylpyrrolidin-1-yl) 2-methylpropanoate;ethane |
| SMILES | CC.CC(=O)OC(N(C)C)=[N+](C)C.CC(C)C(=O)ON1C(=O)CC(S)C1=O |
| InChI | InChI=1S/C8H11NO4S.C7H15N2O2.C2H6/c1-4(2)8(12)13-9-6(10)3-5(14)7(9)11;1-6(10)11-7(8(2)3)9(4)5;1-2/h4-5,14H,3H2,1-2H3;1-5H3;1-2H3/q;+1; |
| InChIKey | XRBVBZRLSRJYOW-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 96.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.53 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|