C8H11NO4S — CID 138475521
(2,5-dioxo-3-sulfanylpyrrolidin-1-yl) 2-methylpropanoate (PubChem CID 138475521) has the molecular formula C8H11NO4S and a molecular weight of 217.25 g/mol. Its IUPAC name is (2,5-dioxo-3-sulfanylpyrrolidin-1-yl) 2-methylpropanoate.
| Compound Name | (2,5-dioxo-3-sulfanylpyrrolidin-1-yl) 2-methylpropanoate |
|---|---|
| PubChem CID | 138475521 |
| Molecular Formula | C8H11NO4S |
| Molecular Weight | 217.25 g/mol |
| Exact Mass | 217.04 |
| IUPAC Name | (2,5-dioxo-3-sulfanylpyrrolidin-1-yl) 2-methylpropanoate |
| SMILES | CC(C)C(=O)ON1C(=O)CC(S)C1=O |
| InChI | InChI=1S/C8H11NO4S/c1-4(2)8(12)13-9-6(10)3-5(14)7(9)11/h4-5,14H,3H2,1-2H3 |
| InChIKey | AUGIVFHGRZEKKK-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 63.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.25 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|