(2,5-dioxo-3-sulfanylpyrrolidin-1-yl) 2-methylpropanoate

C8H11NO4S — CID 138475521

IUPAC(2,5-dioxo-3-sulfanylpyrrolidin-1-yl) 2-methylpropanoate
SMILESCC(C)C(=O)ON1C(=O)CC(S)C1=O
InChIInChI=1S/C8H11NO4S/c1-4(2)8(12)13-9-6(10)3-5(14)7(9)11/h4-5,14H,3H2,1-2H3
InChIKeyAUGIVFHGRZEKKK-UHFFFAOYSA-N
MW217.25 g/mol
LogP0.16
Rot. Bonds2

About (2,5-dioxo-3-sulfanylpyrrolidin-1-yl) 2-methylpropanoate

(2,5-dioxo-3-sulfanylpyrrolidin-1-yl) 2-methylpropanoate (PubChem CID 138475521) has the molecular formula C8H11NO4S and a molecular weight of 217.25 g/mol. Its IUPAC name is (2,5-dioxo-3-sulfanylpyrrolidin-1-yl) 2-methylpropanoate.

Molecular Properties

Compound Name(2,5-dioxo-3-sulfanylpyrrolidin-1-yl) 2-methylpropanoate
PubChem CID138475521
Molecular FormulaC8H11NO4S
Molecular Weight217.25 g/mol
Exact Mass217.04
IUPAC Name(2,5-dioxo-3-sulfanylpyrrolidin-1-yl) 2-methylpropanoate
SMILESCC(C)C(=O)ON1C(=O)CC(S)C1=O
InChIInChI=1S/C8H11NO4S/c1-4(2)8(12)13-9-6(10)3-5(14)7(9)11/h4-5,14H,3H2,1-2H3
InChIKeyAUGIVFHGRZEKKK-UHFFFAOYSA-N
XLogP0.16
TPSA63.68 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds2
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500217.25
LogP ≤ 50.16
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'}

Analyze (2,5-dioxo-3-sulfanylpyrrolidin-1-yl) 2-methylpropanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2,5-dioxo-3-sulfanylpyrrolidin-1-yl) 2-methylpropanoate?
The IUPAC name of (2,5-dioxo-3-sulfanylpyrrolidin-1-yl) 2-methylpropanoate (CID 138475521) is (2,5-dioxo-3-sulfanylpyrrolidin-1-yl) 2-methylpropanoate.
What is the SMILES notation for (2,5-dioxo-3-sulfanylpyrrolidin-1-yl) 2-methylpropanoate?
The canonical SMILES for (2,5-dioxo-3-sulfanylpyrrolidin-1-yl) 2-methylpropanoate is CC(C)C(=O)ON1C(=O)CC(S)C1=O.
What is the InChIKey of (2,5-dioxo-3-sulfanylpyrrolidin-1-yl) 2-methylpropanoate?
The InChIKey is AUGIVFHGRZEKKK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11NO4S/c1-4(2)8(12)13-9-6(10)3-5(14)7(9)11/h4-5,14H,3H2,1-2H3.
What are the key properties of (2,5-dioxo-3-sulfanylpyrrolidin-1-yl) 2-methylpropanoate?
(2,5-dioxo-3-sulfanylpyrrolidin-1-yl) 2-methylpropanoate has a molecular weight of 217.25 g/mol, XLogP of 0.16, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2,5-dioxo-3-sulfanylpyrrolidin-1-yl) 2-methylpropanoate is sourced from PubChem (CID 138475521), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).