C13H22ClNO4 — CID 158531615
2-chloro-3-methylbutane;(2,5-dioxopyrrolidin-1-yl) 2-methylpropanoate (PubChem CID 158531615) has the molecular formula C13H22ClNO4 and a molecular weight of 291.78 g/mol. Its IUPAC name is 2-chloro-3-methylbutane;(2,5-dioxopyrrolidin-1-yl) 2-methylpropanoate.
| Compound Name | 2-chloro-3-methylbutane;(2,5-dioxopyrrolidin-1-yl) 2-methylpropanoate |
|---|---|
| PubChem CID | 158531615 |
| Molecular Formula | C13H22ClNO4 |
| Molecular Weight | 291.78 g/mol |
| Exact Mass | 291.12 |
| IUPAC Name | 2-chloro-3-methylbutane;(2,5-dioxopyrrolidin-1-yl) 2-methylpropanoate |
| SMILES | CC(C)C(=O)ON1C(=O)CCC1=O.CC(C)C(C)Cl |
| InChI | InChI=1S/C8H11NO4.C5H11Cl/c1-5(2)8(12)13-9-6(10)3-4-7(9)11;1-4(2)5(3)6/h5H,3-4H2,1-2H3;4-5H,1-3H3 |
| InChIKey | HNLDAZFHDHXIER-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.78 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|