C9H13NO5 — CID 19911288
(2,5-dioxopyrrolidin-1-yl) 2-methylpropyl carbonate (PubChem CID 19911288) has the molecular formula C9H13NO5 and a molecular weight of 215.20 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 2-methylpropyl carbonate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 2-methylpropyl carbonate |
|---|---|
| PubChem CID | 19911288 |
| Molecular Formula | C9H13NO5 |
| Molecular Weight | 215.20 g/mol |
| Exact Mass | 215.08 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 2-methylpropyl carbonate |
| SMILES | CC(C)COC(=O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C9H13NO5/c1-6(2)5-14-9(13)15-10-7(11)3-4-8(10)12/h6H,3-5H2,1-2H3 |
| InChIKey | LNLUEQNONJYKRK-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.20 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|