C22H28N2O14 — CID 140651778
bis[1-(2,5-dioxopyrrolidin-1-yl)oxycarbonyloxy-2-methylpropyl] butanedioate (PubChem CID 140651778) has the molecular formula C22H28N2O14 and a molecular weight of 544.47 g/mol. Its IUPAC name is bis[1-(2,5-dioxopyrrolidin-1-yl)oxycarbonyloxy-2-methylpropyl] butanedioate.
| Compound Name | bis[1-(2,5-dioxopyrrolidin-1-yl)oxycarbonyloxy-2-methylpropyl] butanedioate |
|---|---|
| PubChem CID | 140651778 |
| Molecular Formula | C22H28N2O14 |
| Molecular Weight | 544.47 g/mol |
| Exact Mass | 544.15 |
| IUPAC Name | bis[1-(2,5-dioxopyrrolidin-1-yl)oxycarbonyloxy-2-methylpropyl] butanedioate |
| SMILES | CC(C)C(OC(=O)CCC(=O)OC(OC(=O)ON1C(=O)CCC1=O)C(C)C)OC(=O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C22H28N2O14/c1-11(2)19(35-21(31)37-23-13(25)5-6-14(23)26)33-17(29)9-10-18(30)34-20(12(3)4)36-22(32)38-24-15(27)7-8-16(24)28/h11-12,19-20H,5-10H2,1-4H3 |
| InChIKey | SXSADSUFJFBJES-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 198.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.47 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|