C11H17NO6 — CID 175750111
(2,5-dioxopyrrolidin-1-yl) 5-methoxypentan-2-yl carbonate (PubChem CID 175750111) has the molecular formula C11H17NO6 and a molecular weight of 259.26 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 5-methoxypentan-2-yl carbonate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 5-methoxypentan-2-yl carbonate |
|---|---|
| PubChem CID | 175750111 |
| Molecular Formula | C11H17NO6 |
| Molecular Weight | 259.26 g/mol |
| Exact Mass | 259.11 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 5-methoxypentan-2-yl carbonate |
| SMILES | COCCCC(C)OC(=O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C11H17NO6/c1-8(4-3-7-16-2)17-11(15)18-12-9(13)5-6-10(12)14/h8H,3-7H2,1-2H3 |
| InChIKey | ADWZVRPCBUPVDT-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.26 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|