About (2,5-dioxopyrrolidin-1-yl) 5-methoxypentan-2-yl carbonate
(2,5-dioxopyrrolidin-1-yl) 5-methoxypentan-2-yl carbonate (PubChem CID 175750111) has the molecular formula C11H17NO6
and a molecular weight of 259.26 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 5-methoxypentan-2-yl carbonate.
Molecular Properties
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 5-methoxypentan-2-yl carbonate |
| PubChem CID | 175750111 |
| Molecular Formula | C11H17NO6 |
| Molecular Weight | 259.26 g/mol |
| Exact Mass | 259.11 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 5-methoxypentan-2-yl carbonate |
| SMILES | COCCCC(C)OC(=O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C11H17NO6/c1-8(4-3-7-16-2)17-11(15)18-12-9(13)5-6-10(12)14/h8H,3-7H2,1-2H3 |
| InChIKey | ADWZVRPCBUPVDT-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.26 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze (2,5-dioxopyrrolidin-1-yl) 5-methoxypentan-2-yl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,5-dioxopyrrolidin-1-yl) 5-methoxypentan-2-yl carbonate?
The IUPAC name of (2,5-dioxopyrrolidin-1-yl) 5-methoxypentan-2-yl carbonate (CID 175750111) is (2,5-dioxopyrrolidin-1-yl) 5-methoxypentan-2-yl carbonate.
What is the SMILES notation for (2,5-dioxopyrrolidin-1-yl) 5-methoxypentan-2-yl carbonate?
The canonical SMILES for (2,5-dioxopyrrolidin-1-yl) 5-methoxypentan-2-yl carbonate is COCCCC(C)OC(=O)ON1C(=O)CCC1=O.
What is the InChIKey of (2,5-dioxopyrrolidin-1-yl) 5-methoxypentan-2-yl carbonate?
The InChIKey is ADWZVRPCBUPVDT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17NO6/c1-8(4-3-7-16-2)17-11(15)18-12-9(13)5-6-10(12)14/h8H,3-7H2,1-2H3.
What are the key properties of (2,5-dioxopyrrolidin-1-yl) 5-methoxypentan-2-yl carbonate?
(2,5-dioxopyrrolidin-1-yl) 5-methoxypentan-2-yl carbonate has a molecular weight of 259.26 g/mol, XLogP of 1.02, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2,5-dioxopyrrolidin-1-yl) 5-methoxypentan-2-yl carbonate is sourced from PubChem (CID 175750111), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).