C15H25NO8 — CID 59859142
(2,5-dioxopyrrolidin-1-yl) 3,3-bis(3-methoxypropoxy)propanoate (PubChem CID 59859142) has the molecular formula C15H25NO8 and a molecular weight of 347.36 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 3,3-bis(3-methoxypropoxy)propanoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 3,3-bis(3-methoxypropoxy)propanoate |
|---|---|
| PubChem CID | 59859142 |
| Molecular Formula | C15H25NO8 |
| Molecular Weight | 347.36 g/mol |
| Exact Mass | 347.16 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 3,3-bis(3-methoxypropoxy)propanoate |
| SMILES | COCCCOC(CC(=O)ON1C(=O)CCC1=O)OCCCOC |
| InChI | InChI=1S/C15H25NO8/c1-20-7-3-9-22-15(23-10-4-8-21-2)11-14(19)24-16-12(17)5-6-13(16)18/h15H,3-11H2,1-2H3 |
| InChIKey | KVXMZSPRWLEUMU-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 100.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.36 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|