C7H9NO5 — CID 10352427
(2,5-dioxopyrrolidin-1-yl) 2-methoxyacetate (PubChem CID 10352427) has the molecular formula C7H9NO5 and a molecular weight of 187.15 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 2-methoxyacetate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 2-methoxyacetate |
|---|---|
| PubChem CID | 10352427 |
| Molecular Formula | C7H9NO5 |
| Molecular Weight | 187.15 g/mol |
| Exact Mass | 187.05 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 2-methoxyacetate |
| SMILES | COCC(=O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C7H9NO5/c1-12-4-7(11)13-8-5(9)2-3-6(8)10/h2-4H2,1H3 |
| InChIKey | KDVRYSGGAUUSIE-UHFFFAOYSA-N |
| XLogP | -0.76 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.15 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|