C16H16N2O10 — CID 102332025
(2,5-dioxopyrrolidin-1-yl) 2-[4-[2-(2,5-dioxopyrrolidin-1-yl)oxy-2-oxoethoxy]but-2-ynoxy]acetate (PubChem CID 102332025) has the molecular formula C16H16N2O10 and a molecular weight of 396.31 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 2-[4-[2-(2,5-dioxopyrrolidin-1-yl)oxy-2-oxoethoxy]but-2-ynoxy]acetate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 2-[4-[2-(2,5-dioxopyrrolidin-1-yl)oxy-2-oxoethoxy]but-2-ynoxy]acetate |
|---|---|
| PubChem CID | 102332025 |
| Molecular Formula | C16H16N2O10 |
| Molecular Weight | 396.31 g/mol |
| Exact Mass | 396.08 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 2-[4-[2-(2,5-dioxopyrrolidin-1-yl)oxy-2-oxoethoxy]but-2-ynoxy]acetate |
| SMILES | O=C(COCC#CCOCC(=O)ON1C(=O)CCC1=O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C16H16N2O10/c19-11-3-4-12(20)17(11)27-15(23)9-25-7-1-2-8-26-10-16(24)28-18-13(21)5-6-14(18)22/h3-10H2 |
| InChIKey | FPMVIQSBVBPMKT-UHFFFAOYSA-N |
| XLogP | -1.76 |
| TPSA | 145.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.31 |
| LogP ≤ 5 | -1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|