C19H22N2O14 — CID 153431412
bis[2-[2-(2,5-dioxopyrrolidin-1-yl)oxy-2-oxoethoxy]ethyl] propanedioate (PubChem CID 153431412) has the molecular formula C19H22N2O14 and a molecular weight of 502.39 g/mol. Its IUPAC name is bis[2-[2-(2,5-dioxopyrrolidin-1-yl)oxy-2-oxoethoxy]ethyl] propanedioate.
| Compound Name | bis[2-[2-(2,5-dioxopyrrolidin-1-yl)oxy-2-oxoethoxy]ethyl] propanedioate |
|---|---|
| PubChem CID | 153431412 |
| Molecular Formula | C19H22N2O14 |
| Molecular Weight | 502.39 g/mol |
| Exact Mass | 502.11 |
| IUPAC Name | bis[2-[2-(2,5-dioxopyrrolidin-1-yl)oxy-2-oxoethoxy]ethyl] propanedioate |
| SMILES | O=C(CC(=O)OCCOCC(=O)ON1C(=O)CCC1=O)OCCOCC(=O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C19H22N2O14/c22-12-1-2-13(23)20(12)34-18(28)10-30-5-7-32-16(26)9-17(27)33-8-6-31-11-19(29)35-21-14(24)3-4-15(21)25/h1-11H2 |
| InChIKey | URAYUQRNVIGDBR-UHFFFAOYSA-N |
| XLogP | -2.29 |
| TPSA | 198.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.39 |
| LogP ≤ 5 | -2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|