C10H12BrNO7 — CID 162642529
(2,5-dioxopyrrolidin-1-yl) 2-[2-(2-bromoacetyl)oxyethoxy]acetate (PubChem CID 162642529) has the molecular formula C10H12BrNO7 and a molecular weight of 338.11 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 2-[2-(2-bromoacetyl)oxyethoxy]acetate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 2-[2-(2-bromoacetyl)oxyethoxy]acetate |
|---|---|
| PubChem CID | 162642529 |
| Molecular Formula | C10H12BrNO7 |
| Molecular Weight | 338.11 g/mol |
| Exact Mass | 336.98 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 2-[2-(2-bromoacetyl)oxyethoxy]acetate |
| SMILES | O=C(CBr)OCCOCC(=O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C10H12BrNO7/c11-5-9(15)18-4-3-17-6-10(16)19-12-7(13)1-2-8(12)14/h1-6H2 |
| InChIKey | CGUDRPYHKIXARD-UHFFFAOYSA-N |
| XLogP | -0.45 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.11 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|