C18H22N4O12 — CID 11092123
(2,5-dioxopyrrolidin-1-yl) 2-[2-[2-[[2-[2-(2,5-dioxopyrrolidin-1-yl)oxy-2-oxoethoxy]acetyl]amino]ethylamino]-2-oxoethoxy]acetate (PubChem CID 11092123) has the molecular formula C18H22N4O12 and a molecular weight of 486.39 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 2-[2-[2-[[2-[2-(2,5-dioxopyrrolidin-1-yl)oxy-2-oxoethoxy]acetyl]amino]ethylamino]-2-oxoethoxy]acetate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 2-[2-[2-[[2-[2-(2,5-dioxopyrrolidin-1-yl)oxy-2-oxoethoxy]acetyl]amino]ethylamino]-2-oxoethoxy]acetate |
|---|---|
| PubChem CID | 11092123 |
| Molecular Formula | C18H22N4O12 |
| Molecular Weight | 486.39 g/mol |
| Exact Mass | 486.12 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 2-[2-[2-[[2-[2-(2,5-dioxopyrrolidin-1-yl)oxy-2-oxoethoxy]acetyl]amino]ethylamino]-2-oxoethoxy]acetate |
| SMILES | O=C(COCC(=O)ON1C(=O)CCC1=O)NCCNC(=O)COCC(=O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C18H22N4O12/c23-11(7-31-9-17(29)33-21-13(25)1-2-14(21)26)19-5-6-20-12(24)8-32-10-18(30)34-22-15(27)3-4-16(22)28/h1-10H2,(H,19,23)(H,20,24) |
| InChIKey | SDGRSCVQYHQNQS-UHFFFAOYSA-N |
| XLogP | -3.53 |
| TPSA | 204.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.39 |
| LogP ≤ 5 | -3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|