C19H30N2O10 — CID 157314738
(2,5-dioxopyrrolidin-1-yl) 2-[2-[2-[[2-[2-(4-oxopentoxy)ethoxy]acetyl]amino]ethoxy]ethoxy]acetate (PubChem CID 157314738) has the molecular formula C19H30N2O10 and a molecular weight of 446.45 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 2-[2-[2-[[2-[2-(4-oxopentoxy)ethoxy]acetyl]amino]ethoxy]ethoxy]acetate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 2-[2-[2-[[2-[2-(4-oxopentoxy)ethoxy]acetyl]amino]ethoxy]ethoxy]acetate |
|---|---|
| PubChem CID | 157314738 |
| Molecular Formula | C19H30N2O10 |
| Molecular Weight | 446.45 g/mol |
| Exact Mass | 446.19 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 2-[2-[2-[[2-[2-(4-oxopentoxy)ethoxy]acetyl]amino]ethoxy]ethoxy]acetate |
| SMILES | CC(=O)CCCOCCOCC(=O)NCCOCCOCC(=O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C19H30N2O10/c1-15(22)3-2-7-27-9-11-29-13-16(23)20-6-8-28-10-12-30-14-19(26)31-21-17(24)4-5-18(21)25/h2-14H2,1H3,(H,20,23) |
| InChIKey | WBUHMSWKPAENIM-UHFFFAOYSA-N |
| XLogP | -0.85 |
| TPSA | 146.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.45 |
| LogP ≤ 5 | -0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|