C18H29N3O10 — CID 59616514
(2,5-dioxopyrrolidin-1-yl) 2-[2-[2-[[2-[2-(2-acetamidoethoxy)ethoxy]acetyl]amino]ethoxy]ethoxy]acetate (PubChem CID 59616514) has the molecular formula C18H29N3O10 and a molecular weight of 447.44 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 2-[2-[2-[[2-[2-(2-acetamidoethoxy)ethoxy]acetyl]amino]ethoxy]ethoxy]acetate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 2-[2-[2-[[2-[2-(2-acetamidoethoxy)ethoxy]acetyl]amino]ethoxy]ethoxy]acetate |
|---|---|
| PubChem CID | 59616514 |
| Molecular Formula | C18H29N3O10 |
| Molecular Weight | 447.44 g/mol |
| Exact Mass | 447.19 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 2-[2-[2-[[2-[2-(2-acetamidoethoxy)ethoxy]acetyl]amino]ethoxy]ethoxy]acetate |
| SMILES | CC(=O)NCCOCCOCC(=O)NCCOCCOCC(=O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C18H29N3O10/c1-14(22)19-4-6-27-8-10-29-12-15(23)20-5-7-28-9-11-30-13-18(26)31-21-16(24)2-3-17(21)25/h2-13H2,1H3,(H,19,22)(H,20,23) |
| InChIKey | QAPGYKATKJOXCN-UHFFFAOYSA-N |
| XLogP | -2.09 |
| TPSA | 158.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.44 |
| LogP ≤ 5 | -2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|