C16H28N2O7 — CID 162199414
N-butyl-2-ethoxyacetamide;(2,5-dioxopyrrolidin-1-yl) 2-ethoxyacetate (PubChem CID 162199414) has the molecular formula C16H28N2O7 and a molecular weight of 360.41 g/mol. Its IUPAC name is N-butyl-2-ethoxyacetamide;(2,5-dioxopyrrolidin-1-yl) 2-ethoxyacetate.
| Compound Name | N-butyl-2-ethoxyacetamide;(2,5-dioxopyrrolidin-1-yl) 2-ethoxyacetate |
|---|---|
| PubChem CID | 162199414 |
| Molecular Formula | C16H28N2O7 |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 360.19 |
| IUPAC Name | N-butyl-2-ethoxyacetamide;(2,5-dioxopyrrolidin-1-yl) 2-ethoxyacetate |
| SMILES | CCCCNC(=O)COCC.CCOCC(=O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C8H11NO5.C8H17NO2/c1-2-13-5-8(12)14-9-6(10)3-4-7(9)11;1-3-5-6-9-8(10)7-11-4-2/h2-5H2,1H3;3-7H2,1-2H3,(H,9,10) |
| InChIKey | ZRJNPTWZZQIQQQ-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 111.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|