C18H23N3O9 — CID 59709155
(2,5-dioxopyrrolidin-1-yl) 2-[2-[2-[4-(2,5-dioxopyrrol-1-yl)butylamino]-2-oxoethoxy]ethoxy]acetate (PubChem CID 59709155) has the molecular formula C18H23N3O9 and a molecular weight of 425.39 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 2-[2-[2-[4-(2,5-dioxopyrrol-1-yl)butylamino]-2-oxoethoxy]ethoxy]acetate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 2-[2-[2-[4-(2,5-dioxopyrrol-1-yl)butylamino]-2-oxoethoxy]ethoxy]acetate |
|---|---|
| PubChem CID | 59709155 |
| Molecular Formula | C18H23N3O9 |
| Molecular Weight | 425.39 g/mol |
| Exact Mass | 425.14 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 2-[2-[2-[4-(2,5-dioxopyrrol-1-yl)butylamino]-2-oxoethoxy]ethoxy]acetate |
| SMILES | O=C(COCCOCC(=O)ON1C(=O)CCC1=O)NCCCCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C18H23N3O9/c22-13(19-7-1-2-8-20-14(23)3-4-15(20)24)11-28-9-10-29-12-18(27)30-21-16(25)5-6-17(21)26/h3-4H,1-2,5-12H2,(H,19,22) |
| InChIKey | GBNWVJXMNGKRBE-UHFFFAOYSA-N |
| XLogP | -1.55 |
| TPSA | 148.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.39 |
| LogP ≤ 5 | -1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|