C16H23N3O8 — CID 59709152
2-[[2-[2-[2-[4-(2,5-dioxopyrrol-1-yl)butylamino]-2-oxoethoxy]ethoxy]acetyl]amino]acetic acid (PubChem CID 59709152) has the molecular formula C16H23N3O8 and a molecular weight of 385.37 g/mol. Its IUPAC name is 2-[[2-[2-[2-[4-(2,5-dioxopyrrol-1-yl)butylamino]-2-oxoethoxy]ethoxy]acetyl]amino]acetic acid.
| Compound Name | 2-[[2-[2-[2-[4-(2,5-dioxopyrrol-1-yl)butylamino]-2-oxoethoxy]ethoxy]acetyl]amino]acetic acid |
|---|---|
| PubChem CID | 59709152 |
| Molecular Formula | C16H23N3O8 |
| Molecular Weight | 385.37 g/mol |
| Exact Mass | 385.15 |
| IUPAC Name | 2-[[2-[2-[2-[4-(2,5-dioxopyrrol-1-yl)butylamino]-2-oxoethoxy]ethoxy]acetyl]amino]acetic acid |
| SMILES | O=C(O)CNC(=O)COCCOCC(=O)NCCCCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C16H23N3O8/c20-12(10-26-7-8-27-11-13(21)18-9-16(24)25)17-5-1-2-6-19-14(22)3-4-15(19)23/h3-4H,1-2,5-11H2,(H,17,20)(H,18,21)(H,24,25) |
| InChIKey | MSHZTQSGKASEHU-UHFFFAOYSA-N |
| XLogP | -1.96 |
| TPSA | 151.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.37 |
| LogP ≤ 5 | -1.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|