C20H33N5O7 — CID 20710719
6-[[2-[2-[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]ethoxy]ethoxy]acetyl]amino]-2-(methylamino)hexanamide (PubChem CID 20710719) has the molecular formula C20H33N5O7 and a molecular weight of 455.51 g/mol. Its IUPAC name is 6-[[2-[2-[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]ethoxy]ethoxy]acetyl]amino]-2-(methylamino)hexanamide.
| Compound Name | 6-[[2-[2-[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]ethoxy]ethoxy]acetyl]amino]-2-(methylamino)hexanamide |
|---|---|
| PubChem CID | 20710719 |
| Molecular Formula | C20H33N5O7 |
| Molecular Weight | 455.51 g/mol |
| Exact Mass | 455.24 |
| IUPAC Name | 6-[[2-[2-[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]ethoxy]ethoxy]acetyl]amino]-2-(methylamino)hexanamide |
| SMILES | CNC(CCCCNC(=O)COCCOCCNC(=O)CCN1C(=O)C=CC1=O)C(N)=O |
| InChI | InChI=1S/C20H33N5O7/c1-22-15(20(21)30)4-2-3-8-23-17(27)14-32-13-12-31-11-9-24-16(26)7-10-25-18(28)5-6-19(25)29/h5-6,15,22H,2-4,7-14H2,1H3,(H2,21,30)(H,23,27)(H,24,26) |
| InChIKey | JZALDSQUQZQNQY-UHFFFAOYSA-N |
| XLogP | -2.19 |
| TPSA | 169.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.51 |
| LogP ≤ 5 | -2.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|