C28H42N7O8PS — CID 90738060
3-(2,5-dioxopyrrol-1-yl)-N-[(5S)-5-(methylamino)-6-oxo-6-thiophosphorosohexyl]propanamide;6-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]-2-(methylamino)hexanamide (PubChem CID 90738060) has the molecular formula C28H42N7O8PS and a molecular weight of 667.73 g/mol. Its IUPAC name is 3-(2,5-dioxopyrrol-1-yl)-N-[(5S)-5-(methylamino)-6-oxo-6-thiophosphorosohexyl]propanamide;6-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]-2-(methylamino)hexanamide.
| Compound Name | 3-(2,5-dioxopyrrol-1-yl)-N-[(5S)-5-(methylamino)-6-oxo-6-thiophosphorosohexyl]propanamide;6-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]-2-(methylamino)hexanamide |
|---|---|
| PubChem CID | 90738060 |
| Molecular Formula | C28H42N7O8PS |
| Molecular Weight | 667.73 g/mol |
| Exact Mass | 667.26 |
| IUPAC Name | 3-(2,5-dioxopyrrol-1-yl)-N-[(5S)-5-(methylamino)-6-oxo-6-thiophosphorosohexyl]propanamide;6-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]-2-(methylamino)hexanamide |
| SMILES | CNC(CCCCNC(=O)CCN1C(=O)C=CC1=O)C(N)=O.CN[C@@H](CCCCNC(=O)CCN1C(=O)C=CC1=O)C(=O)P=S |
| InChI | InChI=1S/C14H22N4O4.C14H20N3O4PS/c1-16-10(14(15)22)4-2-3-8-17-11(19)7-9-18-12(20)5-6-13(18)21;1-15-10(14(21)22-23)4-2-3-8-16-11(18)7-9-17-12(19)5-6-13(17)20/h5-6,10,16H,2-4,7-9H2,1H3,(H2,15,22)(H,17,19);5-6,10,15H,2-4,7-9H2,1H3,(H,16,18)/t;10-/m.0/s1 |
| InChIKey | BWTHVFVWQOBNHS-CICJTZRQSA-N |
| XLogP | -1.23 |
| TPSA | 217.18 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.73 |
| LogP ≤ 5 | -1.23 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|